CAS 2095554-12-2 appears in our catalog under these names: Doxofylline Impurity 4, Doxofylline Impurity 5, Doxofylline Impurity 3, 1-((1,3-Dioxolan-2-yl)methyl)-4-(1,3-dimethylureido)-1H-imidazole-5-carboxylic Acid, 1-(1,3-Dioxolan-2-ylmethyl)-4-[methyl[(methylamino)carbonyl]amino]-1H-imidazole-5-carboxylic acid, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
3-(1,3-dioxolan-2-ylmethyl)-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid (CAS 2095554-12-2) is a chemical compound with the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. IUPAC name: 3-(1,3-dioxolan-2-ylmethyl)-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid. InChIKey: KWPXOXGXVAHIAT-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O5 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-ylmethyl)-5-[methyl(methylcarbamoyl)amino]imidazole-4-carboxylic acid |
| InChIKey | KWPXOXGXVAHIAT-UHFFFAOYSA-N |
| SMILES | CNC(=O)N(C)C1=C(N(C=N1)CC2OCCO2)C(=O)O |
Computed by PubChem (NCBI)