CAS 641569-96-2 appears in our catalog under these names: 3-[(Aminoiminomethyl)amino]-4-methylbenzoic acid ethyl ester mononitrate, 97%, Nilotinib Impurity 22, Ethyl 3-((Diaminomethylidene)amino)-4-methylbenzoate Nitrate, Ethyl 3–Carbamimidoylamino–4–methylbenzoate Nitrate, Ethyl 3-Carbamimidoylamino-4-methylbenzoate Nitrate, >97.0%(HPLC)(T). Offered by: Combi-blocks, Chemat Brand, Mikromol, GLPBio, TCI. Available pack sizes: 100g, 1g, 5g, 25g, on request, 25mg, 10g.
Ethyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid (CAS 641569-96-2) is a chemical compound with the molecular formula C11H16N4O5 and a molecular weight of 284.27 g/mol. IUPAC name: ethyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid. InChIKey: YQMZYKJPGMVZJL-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O5 |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | ethyl 3-(diaminomethylideneamino)-4-methylbenzoate;nitric acid |
| InChIKey | YQMZYKJPGMVZJL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C)N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)