CAS 2095887-20-8 is the registry number for (R)-2-Amino-5,5,5-trifluoro-4,4-dimethylpentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-5,5,5-trifluoro-4,4-dimethylpentanoic acid (CAS 2095887-20-8) is a chemical compound with the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. IUPAC name: (2R)-2-amino-5,5,5-trifluoro-4,4-dimethylpentanoic acid. InChIKey: GBVVWXPGZSMUAZ-SCSAIBSYSA-N.
| Molecular formula | C7H12F3NO2 |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | (2R)-2-amino-5,5,5-trifluoro-4,4-dimethylpentanoic acid |
| InChIKey | GBVVWXPGZSMUAZ-SCSAIBSYSA-N |
| SMILES | CC(C)(C[C@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)