CAS 317845-39-9 is the registry number for (S)-5,5,5-Trifluoro-2-methyl-2-(methylamino)pentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5,5,5-trifluoro-2-methyl-2-(methylamino)pentanoic acid (CAS 317845-39-9) is a chemical compound with the molecular formula C7H12F3NO2 and a molecular weight of 199.17 g/mol. IUPAC name: (2S)-5,5,5-trifluoro-2-methyl-2-(methylamino)pentanoic acid. InChIKey: SHHRWATXMIWJFW-LURJTMIESA-N.
| Molecular formula | C7H12F3NO2 |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | (2S)-5,5,5-trifluoro-2-methyl-2-(methylamino)pentanoic acid |
| InChIKey | SHHRWATXMIWJFW-LURJTMIESA-N |
| SMILES | C[C@](CCC(F)(F)F)(C(=O)O)NC |
Computed by PubChem (NCBI)