CAS 2095926-24-0 appears in our catalog under these names: (S)–Ethyl 2–amino–4–fluoro–4–methylpentanoate hydrochloride, Ethyl (S)-2-amino-4-fluoro-4-methylpentanoate hydrochloride, 97%, 97%, (S)-ethyl 2-amino-4-fluoro-4-methylpentanoate (hydrochloride), 97%, Ethyl (S)-2-amino-4-fluoro-4-methylpentanoate hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl (2S)-2-amino-4-fluoro-4-methylpentanoate;hydrochloride (CAS 2095926-24-0) is a chemical compound with the molecular formula C8H17ClFNO2 and a molecular weight of 213.68 g/mol. IUPAC name: ethyl (2S)-2-amino-4-fluoro-4-methylpentanoate;hydrochloride. InChIKey: JAKZTACOAZGMPR-RGMNGODLSA-N.
| Molecular formula | C8H17ClFNO2 |
|---|---|
| Molecular weight | 213.68 g/mol |
| IUPAC name | ethyl (2S)-2-amino-4-fluoro-4-methylpentanoate;hydrochloride |
| InChIKey | JAKZTACOAZGMPR-RGMNGODLSA-N |
| SMILES | CCOC(=O)[C@H](CC(C)(C)F)N.Cl |
Computed by PubChem (NCBI)