Products 2375258-78-7

CAS 2375258-78-7 is the registry number for tert-Butyl 2-amino-4-fluorobutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-amino-4-fluorobutanoate;hydrochloride (CAS 2375258-78-7) is a chemical compound with the molecular formula C8H17ClFNO2 and a molecular weight of 213.68 g/mol. IUPAC name: tert-butyl 2-amino-4-fluorobutanoate;hydrochloride. InChIKey: QZNNNRBLFICSRN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17ClFNO2
Molecular weight213.68 g/mol
IUPAC nametert-butyl 2-amino-4-fluorobutanoate;hydrochloride
InChIKeyQZNNNRBLFICSRN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C(CCF)N.Cl

Computed by PubChem (NCBI)