CAS 20960-67-2 appears in our catalog under these names: Methyl oleate-d3, Methyl oleate–d3. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg, 50mg.
Trideuteriomethyl (Z)-octadec-9-enoate (CAS 20960-67-2) is a chemical compound with the molecular formula C19H36O2 and a molecular weight of 299.5 g/mol. IUPAC name: trideuteriomethyl (Z)-octadec-9-enoate. InChIKey: QYDYPVFESGNLHU-OEZTXSLXSA-N.
| Molecular formula | C19H36O2 |
|---|---|
| Molecular weight | 299.5 g/mol |
| IUPAC name | trideuteriomethyl (Z)-octadec-9-enoate |
| InChIKey | QYDYPVFESGNLHU-OEZTXSLXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)CCCCCCC/C=C\CCCCCCCC |
Computed by PubChem (NCBI)