CAS 2096329-83-6 appears in our catalog under these names: 4-Fluoro-3-propanoylphenylboronic acid, 95%, (4-Fluoro-3-propionylphenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
(4-fluoro-3-propanoylphenyl)boronic acid (CAS 2096329-83-6) is a chemical compound with the molecular formula C9H10BFO3 and a molecular weight of 195.99 g/mol. IUPAC name: (4-fluoro-3-propanoylphenyl)boronic acid. InChIKey: HPOHGJFFCSHEMG-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO3 |
|---|---|
| Molecular weight | 195.99 g/mol |
| IUPAC name | (4-fluoro-3-propanoylphenyl)boronic acid |
| InChIKey | HPOHGJFFCSHEMG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)CC)(O)O |
Computed by PubChem (NCBI)