Products 850593-00-9

CAS 850593-00-9 is the registry number for B-[3-FLUORO-5-(2-PROPEN-1-YLOXY)PHENYL]BORONIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

(3-fluoro-5-prop-2-enoxyphenyl)boronic acid (CAS 850593-00-9) is a chemical compound with the molecular formula C9H10BFO3 and a molecular weight of 195.99 g/mol. IUPAC name: (3-fluoro-5-prop-2-enoxyphenyl)boronic acid. InChIKey: VZZARKWRFKISNM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BFO3
Molecular weight195.99 g/mol
IUPAC name(3-fluoro-5-prop-2-enoxyphenyl)boronic acid
InChIKeyVZZARKWRFKISNM-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)F)OCC=C)(O)O

Computed by PubChem (NCBI)