Products 2096329-85-8

CAS 2096329-85-8 is the registry number for 3-Butoxy-2,4-difluoro-5-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

(3-butoxy-2,4-difluoro-5-methylphenyl)boronic acid (CAS 2096329-85-8) is a chemical compound with the molecular formula C11H15BF2O3 and a molecular weight of 244.04 g/mol. IUPAC name: (3-butoxy-2,4-difluoro-5-methylphenyl)boronic acid. InChIKey: BWJVKSCSCMDKKR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15BF2O3
Molecular weight244.04 g/mol
IUPAC name(3-butoxy-2,4-difluoro-5-methylphenyl)boronic acid
InChIKeyBWJVKSCSCMDKKR-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1F)OCCCC)F)C)(O)O

Computed by PubChem (NCBI)