Products 2096339-91-0

CAS 2096339-91-0 is the registry number for 2,4-Difluoro-5-methyl-3-(2-methylpropoxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 25g.

Structural formula: {0} (CAS {1})

[2,4-difluoro-5-methyl-3-(2-methylpropoxy)phenyl]boronic acid (CAS 2096339-91-0) is a chemical compound with the molecular formula C11H15BF2O3 and a molecular weight of 244.04 g/mol. IUPAC name: [2,4-difluoro-5-methyl-3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: PWUXQRDZKKRLMP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15BF2O3
Molecular weight244.04 g/mol
IUPAC name[2,4-difluoro-5-methyl-3-(2-methylpropoxy)phenyl]boronic acid
InChIKeyPWUXQRDZKKRLMP-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1F)OCC(C)C)F)C)(O)O

Computed by PubChem (NCBI)