CAS 2096339-91-0 is the registry number for 2,4-Difluoro-5-methyl-3-(2-methylpropoxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 25g.
[2,4-difluoro-5-methyl-3-(2-methylpropoxy)phenyl]boronic acid (CAS 2096339-91-0) is a chemical compound with the molecular formula C11H15BF2O3 and a molecular weight of 244.04 g/mol. IUPAC name: [2,4-difluoro-5-methyl-3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: PWUXQRDZKKRLMP-UHFFFAOYSA-N.
| Molecular formula | C11H15BF2O3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | [2,4-difluoro-5-methyl-3-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | PWUXQRDZKKRLMP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OCC(C)C)F)C)(O)O |
Computed by PubChem (NCBI)