CAS 2096330-26-4 is the registry number for 4-(Benzyloxycarbamoyl)benzeneboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2096330-26-4) is a chemical compound with the molecular formula C20H24BNO4 and a molecular weight of 353.2 g/mol. IUPAC name: N-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: XECXLZBBBRYLFW-UHFFFAOYSA-N.
| Molecular formula | C20H24BNO4 |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | N-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | XECXLZBBBRYLFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NOCC3=CC=CC=C3 |
Computed by PubChem (NCBI)