CAS 2096995-72-9 is the registry number for 4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl 2-(phenylamino)acetate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 2-anilinoacetate (CAS 2096995-72-9) is a chemical compound with the molecular formula C20H24BNO4 and a molecular weight of 353.2 g/mol. IUPAC name: [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 2-anilinoacetate. InChIKey: YCTKHXXLBXRANU-UHFFFAOYSA-N.
| Molecular formula | C20H24BNO4 |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | [4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] 2-anilinoacetate |
| InChIKey | YCTKHXXLBXRANU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC(=O)CNC3=CC=CC=C3 |
Computed by PubChem (NCBI)