CAS 2096330-96-8 is the registry number for 4-(N,N-Diethylsulfamoyl)-2-trifluoromethylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-(diethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid (CAS 2096330-96-8) is a chemical compound with the molecular formula C11H15BF3NO4S and a molecular weight of 325.12 g/mol. IUPAC name: [4-(diethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: MKOTXEGQVGUGSE-UHFFFAOYSA-N.
| Molecular formula | C11H15BF3NO4S |
|---|---|
| Molecular weight | 325.12 g/mol |
| IUPAC name | [4-(diethylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MKOTXEGQVGUGSE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)N(CC)CC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)