CAS 2096333-30-9 is the registry number for 4-(N-tert-Butylsulfamoyl)-2-trifluoromethylphenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(tert-butylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid (CAS 2096333-30-9) is a chemical compound with the molecular formula C11H15BF3NO4S and a molecular weight of 325.12 g/mol. IUPAC name: [4-(tert-butylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: HMGRMEBSMVAFEP-UHFFFAOYSA-N.
| Molecular formula | C11H15BF3NO4S |
|---|---|
| Molecular weight | 325.12 g/mol |
| IUPAC name | [4-(tert-butylsulfamoyl)-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | HMGRMEBSMVAFEP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)NC(C)(C)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)