CAS 2096331-74-5 is the registry number for 3-(2-Bromoacetamido)phenylboronic acid, pinacol ester, 96%. Offered by: Fluorochem. Available pack sizes: 250mg.
2-bromo-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 2096331-74-5) is a chemical compound with the molecular formula C14H19BBrNO3 and a molecular weight of 340.02 g/mol. IUPAC name: 2-bromo-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: UVTPWSKSUQJQOW-UHFFFAOYSA-N.
| Molecular formula | C14H19BBrNO3 |
|---|---|
| Molecular weight | 340.02 g/mol |
| IUPAC name | 2-bromo-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | UVTPWSKSUQJQOW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)NC(=O)CBr |
Computed by PubChem (NCBI)