CAS 2096333-96-7 appears in our catalog under these names: 2-Bromomethyl-5-nitrophenylboronic acid, pinacol ester, 96%, 2–Bromomethyl–5–nitrophenylboronic acid, pinacol ester, 2-Bromomethyl-5-nitrophenylboronic acid, pinacol ester 96%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-[2-(bromomethyl)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2096333-96-7) is a chemical compound with the molecular formula C13H17BBrNO4 and a molecular weight of 342.00 g/mol. IUPAC name: 2-[2-(bromomethyl)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QXAHEYUNZWPODZ-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrNO4 |
|---|---|
| Molecular weight | 342.00 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-5-nitrophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QXAHEYUNZWPODZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)