CAS 2377608-48-3 is the registry number for 3-Bromo-5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[3-bromo-5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]boronic acid (CAS 2377608-48-3) is a chemical compound with the molecular formula C13H17BBrNO4 and a molecular weight of 342.00 g/mol. IUPAC name: [3-bromo-5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]boronic acid. InChIKey: GTWHTOAHTKXGCD-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrNO4 |
|---|---|
| Molecular weight | 342.00 g/mol |
| IUPAC name | [3-bromo-5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]boronic acid |
| InChIKey | GTWHTOAHTKXGCD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)N2CCC3(CC2)OCCO3)(O)O |
Computed by PubChem (NCBI)