Products 2096334-11-9

CAS 2096334-11-9 is the registry number for 3-(Cbz-Amino)-2-fluorophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[2-fluoro-3-(phenylmethoxycarbonylamino)phenyl]boronic acid (CAS 2096334-11-9) is a chemical compound with the molecular formula C14H13BFNO4 and a molecular weight of 289.07 g/mol. IUPAC name: [2-fluoro-3-(phenylmethoxycarbonylamino)phenyl]boronic acid. InChIKey: GPYSCKJJXWJIPC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13BFNO4
Molecular weight289.07 g/mol
IUPAC name[2-fluoro-3-(phenylmethoxycarbonylamino)phenyl]boronic acid
InChIKeyGPYSCKJJXWJIPC-UHFFFAOYSA-N
SMILESB(C1=C(C(=CC=C1)NC(=O)OCC2=CC=CC=C2)F)(O)O

Computed by PubChem (NCBI)