CAS 874290-61-6 appears in our catalog under these names: 3-(Cbz-Amino)-5-fluorophenylboronic acid, 95%, (3-(((Benzyloxy)carbonyl)amino)-5-fluorophenyl)boronic acid, 98%, 3-(Cbz-Amino)-5-fluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, TRC. Available pack sizes: 1g, 5g, 10g, 250mg.
[3-fluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid (CAS 874290-61-6) is a chemical compound with the molecular formula C14H13BFNO4 and a molecular weight of 289.07 g/mol. IUPAC name: [3-fluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid. InChIKey: NTWYMKQJTIUFRD-UHFFFAOYSA-N.
| Molecular formula | C14H13BFNO4 |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | [3-fluoro-5-(phenylmethoxycarbonylamino)phenyl]boronic acid |
| InChIKey | NTWYMKQJTIUFRD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)NC(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)