CAS 2096334-55-1 is the registry number for 4-(N-Cbz-N-Methylamino)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 2096334-55-1) is a chemical compound with the molecular formula C21H26BNO4 and a molecular weight of 367.2 g/mol. IUPAC name: benzyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: NLZRNRXPMFFWBL-UHFFFAOYSA-N.
| Molecular formula | C21H26BNO4 |
|---|---|
| Molecular weight | 367.2 g/mol |
| IUPAC name | benzyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | NLZRNRXPMFFWBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(C)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)