CAS 2377606-15-8 is the registry number for N-Cbz-4-Amino-2-methylphenylboronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 2377606-15-8) is a chemical compound with the molecular formula C21H26BNO4 and a molecular weight of 367.2 g/mol. IUPAC name: benzyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: HBXOMMUBMKHJCU-UHFFFAOYSA-N.
| Molecular formula | C21H26BNO4 |
|---|---|
| Molecular weight | 367.2 g/mol |
| IUPAC name | benzyl N-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | HBXOMMUBMKHJCU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)