CAS 2096334-69-7 is the registry number for 2-(N-Methylaminomethyl)-5-fluorophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylmethanamine (CAS 2096334-69-7) is a chemical compound with the molecular formula C14H21BFNO2 and a molecular weight of 265.13 g/mol. IUPAC name: 1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylmethanamine. InChIKey: HXKMEAWDBRQUJO-UHFFFAOYSA-N.
| Molecular formula | C14H21BFNO2 |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | 1-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylmethanamine |
| InChIKey | HXKMEAWDBRQUJO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)CNC |
Computed by PubChem (NCBI)