CAS 2098216-20-5 is the registry number for 5-Fluoro-2-isopropyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-2-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2098216-20-5) is a chemical compound with the molecular formula C14H21BFNO2 and a molecular weight of 265.13 g/mol. IUPAC name: 5-fluoro-2-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: RWCYWTKZTRAPLY-UHFFFAOYSA-N.
| Molecular formula | C14H21BFNO2 |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | 5-fluoro-2-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | RWCYWTKZTRAPLY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2C(C)C)F |
Computed by PubChem (NCBI)