CAS 2096341-76-1 appears in our catalog under these names: 2-Butylamino-5-pyridineboronic acid, pinacol ester, 97%, 2-Butylamino-5-pyridineboronic acid, pinacol ester, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 2096341-76-1) is a chemical compound with the molecular formula C15H25BN2O2 and a molecular weight of 276.18 g/mol. IUPAC name: N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: ILFMZOJLPSGKNP-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O2 |
|---|---|
| Molecular weight | 276.18 g/mol |
| IUPAC name | N-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | ILFMZOJLPSGKNP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)NCCCC |
Computed by PubChem (NCBI)