CAS 2223027-21-0 is the registry number for 2-(tert-Butyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine (CAS 2223027-21-0) is a chemical compound with the molecular formula C15H25BN2O2 and a molecular weight of 276.18 g/mol. IUPAC name: 2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine. InChIKey: NZKRGNFPWGPMRF-UHFFFAOYSA-N.
| Molecular formula | C15H25BN2O2 |
|---|---|
| Molecular weight | 276.18 g/mol |
| IUPAC name | 2-tert-butyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-4-amine |
| InChIKey | NZKRGNFPWGPMRF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2N)C(C)(C)C |
Computed by PubChem (NCBI)