CAS 209671-12-5 is the registry number for 5-((2,4-Dimethylphenyl)amino)-1,3,4-thiadiazole-2-thiol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(2,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 209671-12-5) is a chemical compound with the molecular formula C10H11N3S2 and a molecular weight of 237.3 g/mol. IUPAC name: 5-(2,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: OAVVZALYHPMJPU-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S2 |
|---|---|
| Molecular weight | 237.3 g/mol |
| IUPAC name | 5-(2,4-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | OAVVZALYHPMJPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=NNC(=S)S2)C |
Computed by PubChem (NCBI)