CAS 379254-69-0 appears in our catalog under these names: 5-[(2,3-Dimethylphenyl)amino]-1,3,4-thiadiazole-2-thiol, 95%, 5-((2,3-Dimethylphenyl)amino)-1,3,4-thiadiazole-2-thiol, 95%, 5-((2,3-Dimethylphenyl)amino)-1,3,4-thiadiazole-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
5-(2,3-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 379254-69-0) is a chemical compound with the molecular formula C10H11N3S2 and a molecular weight of 237.3 g/mol. IUPAC name: 5-(2,3-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: NHCVLGDUKSMZAG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S2 |
|---|---|
| Molecular weight | 237.3 g/mol |
| IUPAC name | 5-(2,3-dimethylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | NHCVLGDUKSMZAG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=NNC(=S)S2)C |
Computed by PubChem (NCBI)