Products 2097013-73-3
CAS 2097013-73-3 is the registry number for Methyl 4-bromo-2-(bromomethyl)-3-chlorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-2-(bromomethyl)-3-chlorobenzoate (CAS 2097013-73-3) is a chemical compound with the molecular formula C9H7Br2ClO2 and a molecular weight of 342.41 g/mol. IUPAC name: methyl 4-bromo-2-(bromomethyl)-3-chlorobenzoate. InChIKey: BYXGEAQXWUUSSY-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2ClO2 |
|---|---|
| Molecular weight | 342.41 g/mol |
| IUPAC name | methyl 4-bromo-2-(bromomethyl)-3-chlorobenzoate |
| InChIKey | BYXGEAQXWUUSSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)Cl)CBr |
Computed by PubChem (NCBI)