Products 24653-99-4
CAS 24653-99-4 is the registry number for 2,3-Dibromo-3-(4-chlorophenyl)propanoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2,3-dibromo-3-(4-chlorophenyl)propanoic acid (CAS 24653-99-4) is a chemical compound with the molecular formula C9H7Br2ClO2 and a molecular weight of 342.41 g/mol. IUPAC name: 2,3-dibromo-3-(4-chlorophenyl)propanoic acid. InChIKey: VVMCVHQTBODLRQ-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2ClO2 |
|---|---|
| Molecular weight | 342.41 g/mol |
| IUPAC name | 2,3-dibromo-3-(4-chlorophenyl)propanoic acid |
| InChIKey | VVMCVHQTBODLRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C(=O)O)Br)Br)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3-Dibromo-3-(4-chlorophenyl)propanoic acid, 2,3-Dibromo-3-(p-chlorophenyl)propionic acid, p-Chlorocinnamic acid dibromide, 2,3-Dibromo-3-(4-chlorophenyl)propanoicacid, VVMCVHQTBODLRQ-UHFFFAOYSA-N, 2,3-Dibromo-3-(4-chlorophenyl)propanoic acid #, Benzenepropanoic acid, alpha,beta-dibromo-4-chloro-