CAS 2097073-21-5 appears in our catalog under these names: (R)–1–Amino–indan–4–ol hydrochloride, (R)-1-Amino-indan-4-ol hydrochloride 96%, (1R)-1-Amino-2,3-dihydro-1H-Inden-4-ol hydrochloride, 96%, 96%, (R)-1-Amino-indan-4-ol hydrochloride, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg, 1g, 5g, 500mg.
(1R)-1-amino-2,3-dihydro-1H-inden-4-ol;hydrochloride (CAS 2097073-21-5) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (1R)-1-amino-2,3-dihydro-1H-inden-4-ol;hydrochloride. InChIKey: KTLOQNUHOBFPFP-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (1R)-1-amino-2,3-dihydro-1H-inden-4-ol;hydrochloride |
| InChIKey | KTLOQNUHOBFPFP-DDWIOCJRSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC=C2O.Cl |
Computed by PubChem (NCBI)