Products 2097787-75-0
CAS 2097787-75-0 appears in our catalog under these names: Nur77 modulator 3, Nur77 modulator 3, 99.01%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 25 mg, 5 mg, 50 mg.
1-[(E)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)thiourea (CAS 2097787-75-0) is a chemical compound with the molecular formula C17H16N4S and a molecular weight of 308.4 g/mol. IUPAC name: 1-[(E)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)thiourea. InChIKey: PLURIIVXGBZIRM-YBFXNURJSA-N.
| Molecular formula | C17H16N4S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 1-[(E)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)thiourea |
| InChIKey | PLURIIVXGBZIRM-YBFXNURJSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=S)N/N=C/C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)