Products 2924883-83-8
CAS 2924883-83-8 is the registry number for DPP-21. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,2-dimethyl-N-(1-methylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine (CAS 2924883-83-8) is a chemical compound with the molecular formula C17H16N4S and a molecular weight of 308.4 g/mol. IUPAC name: N,2-dimethyl-N-(1-methylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine. InChIKey: WTDOSEGYWYJIAO-UHFFFAOYSA-N.
| Molecular formula | C17H16N4S |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | N,2-dimethyl-N-(1-methylindol-5-yl)thieno[3,2-d]pyrimidin-4-amine |
| InChIKey | WTDOSEGYWYJIAO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)N(C)C3=CC4=C(C=C3)N(C=C4)C)SC=C2 |
Computed by PubChem (NCBI)