CAS 2097935-51-6 appears in our catalog under these names: 10,10-Difluoro-7-azadispiro[2.0.5(4).1(3)]decane hydrochloride, 95%, 10,10-difluoro-7-azadispiro(2.0.54.13)decane hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
10,10-difluoro-7-azadispiro[2.0.54.13]decane;hydrochloride (CAS 2097935-51-6) is a chemical compound with the molecular formula C9H14ClF2N and a molecular weight of 209.66 g/mol. IUPAC name: 10,10-difluoro-7-azadispiro[2.0.54.13]decane;hydrochloride. InChIKey: CWOHQELROPQPRG-UHFFFAOYSA-N.
| Molecular formula | C9H14ClF2N |
|---|---|
| Molecular weight | 209.66 g/mol |
| IUPAC name | 10,10-difluoro-7-azadispiro[2.0.54.13]decane;hydrochloride |
| InChIKey | CWOHQELROPQPRG-UHFFFAOYSA-N |
| SMILES | C1CC12C3(C2(F)F)CCNCC3.Cl |
Computed by PubChem (NCBI)