Products 2378507-04-9
CAS 2378507-04-9 is the registry number for 9,9-Difluorodispiro(3.0.3{5}.1{4})nonan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9,9-difluorodispiro[3.0.35.14]nonan-7-amine;hydrochloride (CAS 2378507-04-9) is a chemical compound with the molecular formula C9H14ClF2N and a molecular weight of 209.66 g/mol. IUPAC name: 9,9-difluorodispiro[3.0.35.14]nonan-7-amine;hydrochloride. InChIKey: UXQSRFNYYCHPBR-UHFFFAOYSA-N.
| Molecular formula | C9H14ClF2N |
|---|---|
| Molecular weight | 209.66 g/mol |
| IUPAC name | 9,9-difluorodispiro[3.0.35.14]nonan-7-amine;hydrochloride |
| InChIKey | UXQSRFNYYCHPBR-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C3(C2(F)F)CC(C3)N.Cl |
Computed by PubChem (NCBI)