CAS 2097982-05-1 is the registry number for Tofacitinib Impurity 3. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 500mg, 1000mg, 5000mg.
(3R,4R)-N,4-dimethyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-amine (CAS 2097982-05-1) is a chemical compound with the molecular formula C13H19N5 and a molecular weight of 245.32 g/mol. IUPAC name: (3R,4R)-N,4-dimethyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-amine. InChIKey: MZLXAYQSECRJPN-KOLCDFICSA-N.
| Molecular formula | C13H19N5 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (3R,4R)-N,4-dimethyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-amine |
| InChIKey | MZLXAYQSECRJPN-KOLCDFICSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)C2=NC=NC3=C2C=CN3 |
Computed by PubChem (NCBI)