CAS 2374700-39-5 appears in our catalog under these names: N-Methyl-N-((3R,4R)-4-methylpiperidin-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine, 98%, Tofacitinib Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine (CAS 2374700-39-5) is a chemical compound with the molecular formula C13H19N5 and a molecular weight of 245.32 g/mol. IUPAC name: N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine. InChIKey: IUROZHGZCXNOHH-KOLCDFICSA-N.
| Molecular formula | C13H19N5 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | N-methyl-N-[(3R,4R)-4-methylpiperidin-3-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| InChIKey | IUROZHGZCXNOHH-KOLCDFICSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1N(C)C2=NC=C3C=CNC3=N2 |
Computed by PubChem (NCBI)