CAS 2098033-24-8 appears in our catalog under these names: Rac-2-((1R,3S)-3-aminocyclopentyl)acetonitrile hydrochloride, 95%, rac-2-((1R,3S)-3-Aminocyclopentyl)acetonitrile hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(1R,3S)-3-aminocyclopentyl]acetonitrile;hydrochloride (CAS 2098033-24-8) is a chemical compound with the molecular formula C7H13ClN2 and a molecular weight of 160.64 g/mol. IUPAC name: 2-[(1R,3S)-3-aminocyclopentyl]acetonitrile;hydrochloride. InChIKey: VUSFXQAGYDHBGU-LEUCUCNGSA-N.
| Molecular formula | C7H13ClN2 |
|---|---|
| Molecular weight | 160.64 g/mol |
| IUPAC name | 2-[(1R,3S)-3-aminocyclopentyl]acetonitrile;hydrochloride |
| InChIKey | VUSFXQAGYDHBGU-LEUCUCNGSA-N |
| SMILES | C1C[C@@H](C[C@@H]1CC#N)N.Cl |
Computed by PubChem (NCBI)