Products 2098078-71-6
CAS 2098078-71-6 is the registry number for 2-(1-(Cyclopropylmethyl)-3-(trifluoromethyl)-1H-pyrazol-4-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 1000mg.
2-[1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazol-4-yl]acetonitrile (CAS 2098078-71-6) is a chemical compound with the molecular formula C10H10F3N3 and a molecular weight of 229.20 g/mol. IUPAC name: 2-[1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazol-4-yl]acetonitrile. InChIKey: ZSSOVHCVXZWOAZ-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N3 |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | 2-[1-(cyclopropylmethyl)-3-(trifluoromethyl)pyrazol-4-yl]acetonitrile |
| InChIKey | ZSSOVHCVXZWOAZ-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C=C(C(=N2)C(F)(F)F)CC#N |
Computed by PubChem (NCBI)