CAS 828241-99-2 appears in our catalog under these names: [1-Methyl-5-(trifluoromethyl)-1h-benzimidazol-2-yl]methylamine, 95%, (1-Methyl-5-(trifluoromethyl)-1H-benzo(d)imidazol-2-yl)methanamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10G, 1g, 250mg.
[1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methanamine (CAS 828241-99-2) is a chemical compound with the molecular formula C10H10F3N3 and a molecular weight of 229.20 g/mol. IUPAC name: [1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methanamine. InChIKey: IDMFQDHIVDCRQN-UHFFFAOYSA-N.
| Molecular formula | C10H10F3N3 |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | [1-methyl-5-(trifluoromethyl)benzimidazol-2-yl]methanamine |
| InChIKey | IDMFQDHIVDCRQN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(F)(F)F)N=C1CN |
Computed by PubChem (NCBI)