Products 2098812-49-6
CAS 2098812-49-6 is the registry number for 1-((4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)-1H-pyrrole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrole (CAS 2098812-49-6) is a chemical compound with the molecular formula C16H20BNO4S and a molecular weight of 333.2 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrole. InChIKey: NWVOCOODLSPQQE-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4S |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpyrrole |
| InChIKey | NWVOCOODLSPQQE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(=O)(=O)N3C=CC=C3 |
Computed by PubChem (NCBI)