CAS 1704121-04-9 is the registry number for (4–((4–Methylpiperidin–1–yl)sulfonyl) naphthalen–1–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-(4-methylpiperidin-1-yl)sulfonylnaphthalen-1-yl]boronic acid (CAS 1704121-04-9) is a chemical compound with the molecular formula C16H20BNO4S and a molecular weight of 333.2 g/mol. IUPAC name: [4-(4-methylpiperidin-1-yl)sulfonylnaphthalen-1-yl]boronic acid. InChIKey: JKKZHTWNWDESDA-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4S |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | [4-(4-methylpiperidin-1-yl)sulfonylnaphthalen-1-yl]boronic acid |
| InChIKey | JKKZHTWNWDESDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)S(=O)(=O)N3CCC(CC3)C)(O)O |
Computed by PubChem (NCBI)