CAS 2377605-95-1 appears in our catalog under these names: 1-(Benzenesulfonyl)pyrrole-2-boronic acid, pinacol ester, 95%, 1-(Phenylsulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g.
1-(benzenesulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole (CAS 2377605-95-1) is a chemical compound with the molecular formula C16H20BNO4S and a molecular weight of 333.2 g/mol. IUPAC name: 1-(benzenesulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole. InChIKey: CXVJEWBKHTYGOH-UHFFFAOYSA-N.
| Molecular formula | C16H20BNO4S |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole |
| InChIKey | CXVJEWBKHTYGOH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CN2S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)