Products 209919-30-2
CAS 209919-30-2 appears in our catalog under these names: 4-Chloro-2-methylphenylboronic acid 98%, 4-Chloro-2-methylphenylboronic acid, 97%, 4-Chloro-2-methylphenylboronic acid, 98%, 98%, 4–Chloro–2–methylphenylboronic Acid (contains varying amounts of Anhydride), 4-Chloro-2-methylphenylboronic Acid (contains varying amounts of Anhydride). Offered by: Ambeed, Fluorochem, Chemat, GLPBio, TCI. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(4-chloro-2-methylphenyl)boronic acid (CAS 209919-30-2) is a chemical compound with the molecular formula C7H8BClO2 and a molecular weight of 170.40 g/mol. IUPAC name: (4-chloro-2-methylphenyl)boronic acid. InChIKey: SRXXSLUUAWHGBZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO2 |
|---|---|
| Molecular weight | 170.40 g/mol |
| IUPAC name | (4-chloro-2-methylphenyl)boronic acid |
| InChIKey | SRXXSLUUAWHGBZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-chloro-2-methylphenyl)boronic acid, 4-Chloro-2-methylphenylboronic acid, 4-chloro-2-methylbenzeneboronic acid, 4-Chloro-o-tolylboronic acid, (4-chloro-2-methyl-phenyl)boronic Acid, 2-methyl-4-chlorophenylboronic acid, 2-methyl-4-chloro-phenylboronic acid, 2-methyl-4-chlorophenyl-boronic acid, (4-chloro-2-methylphenyl) boronic acid, 4-Chloro-2-methylphenylboronic Acid (contains varying amounts of Anhydride)