CAS 915070-53-0 appears in our catalog under these names: 2-Chloro-3-methylphenylboronic acid, 95%, 2-Chloro-3-methylphenylboronic acid, ≥95%, ≥95%, (2-Chloro-3-methylphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g.
(2-chloro-3-methylphenyl)boronic acid (CAS 915070-53-0) is a chemical compound with the molecular formula C7H8BClO2 and a molecular weight of 170.40 g/mol. IUPAC name: (2-chloro-3-methylphenyl)boronic acid. InChIKey: JARHIHWQCALALV-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO2 |
|---|---|
| Molecular weight | 170.40 g/mol |
| IUPAC name | (2-chloro-3-methylphenyl)boronic acid |
| InChIKey | JARHIHWQCALALV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C)Cl)(O)O |
Computed by PubChem (NCBI)