CAS 2099669-86-8 is the registry number for (Anthracene-9,10-diylbis(4,1-phenylene))dimethanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[10-[4-(hydroxymethyl)phenyl]anthracen-9-yl]phenyl]methanol (CAS 2099669-86-8) is a chemical compound with the molecular formula C28H22O2 and a molecular weight of 390.5 g/mol. IUPAC name: [4-[10-[4-(hydroxymethyl)phenyl]anthracen-9-yl]phenyl]methanol. InChIKey: UTFOANJFRJGWCT-UHFFFAOYSA-N.
| Molecular formula | C28H22O2 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | [4-[10-[4-(hydroxymethyl)phenyl]anthracen-9-yl]phenyl]methanol |
| InChIKey | UTFOANJFRJGWCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC=C(C=C4)CO)C5=CC=C(C=C5)CO |
Computed by PubChem (NCBI)