CAS 6712-54-5 appears in our catalog under these names: 9H,9'H-(9,9'-Bifluorene)-9,9'-diyldimethanol, 98%, [9,9′-Bi-9H-Fluorene]-9,9′-dimethanol, 98%, 98%, [9,9′-Bi-9H-Fluorene]-9,9′-dimethanol, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
[9-[9-(hydroxymethyl)fluoren-9-yl]fluoren-9-yl]methanol (CAS 6712-54-5) is a chemical compound with the molecular formula C28H22O2 and a molecular weight of 390.5 g/mol. IUPAC name: [9-[9-(hydroxymethyl)fluoren-9-yl]fluoren-9-yl]methanol. InChIKey: NTQOBPFZLYOXLS-UHFFFAOYSA-N.
| Molecular formula | C28H22O2 |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | [9-[9-(hydroxymethyl)fluoren-9-yl]fluoren-9-yl]methanol |
| InChIKey | NTQOBPFZLYOXLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(CO)C4(C5=CC=CC=C5C6=CC=CC=C64)CO |
Computed by PubChem (NCBI)