CAS 209991-64-0 appears in our catalog under these names: 2-Fluoro-4-(trifluoromethyl)phenylacetic acid, 95%, 2–Fluoro–4–(trifluoromethyl)Phenylacetic Acid, 2-Fluoro-4-(trifluoromethyl)phenylacetic acid 98%, 2-Fluoro-4-(trifluoromethyl)phenylacetic acid, 98%, 98%, 2-Fluoro-4-(trifluoromethyl)phenylacetic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g, 500mg.
2-[2-fluoro-4-(trifluoromethyl)phenyl]acetic acid (CAS 209991-64-0) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-[2-fluoro-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: LUIOBGWYVHPKRC-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | LUIOBGWYVHPKRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)CC(=O)O |
Computed by PubChem (NCBI)