CAS 210100-25-7 is the registry number for L-Galactose-1-phosphate. Offered by: Biosynth. Available pack sizes: 1g.
L-galactose 1-phosphate is a galactose phosphate compound with undefined anomeric stereochemistry having L-configuration and the phosphate group at the 1-position. It has a role as a fundamental metabolite. It is functionally related to a L-galactopyranose. It is a conjugate acid of a L-galactose 1-phosphate(2-).
Source: ChEBI
| Molecular formula | C6H13O9P |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | [(3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| InChIKey | HXXFSFRBOHSIMQ-DHVFOXMCSA-N |
| SMILES | C([C@H]1[C@H]([C@H]([C@@H](C(O1)OP(=O)(O)O)O)O)O)O |
Computed by PubChem (NCBI)