CAS 27251-84-9 is the registry number for Mannose 1-phosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
D-mannose 1-phosphate is a mannose phosphate that is D-mannose carrying a phosphate group at position 1. It has a role as a human metabolite and a fundamental metabolite. It is functionally related to a D-mannopyranose.
Source: ChEBI
| Molecular formula | C6H13O9P |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | [(3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] dihydrogen phosphate |
| InChIKey | HXXFSFRBOHSIMQ-QTVWNMPRSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H](C(O1)OP(=O)(O)O)O)O)O)O |
Computed by PubChem (NCBI)